LilMissTQ6269 LilMissTQ6269

12-09-2022
Mathematics

contestada

How can you rewrite the equation x²+12 x+5=3 so the left side of the equation is in the form (x+a)² ?
a. (x-6)²=28 b. (x+6)²=34 c. (x+6)²=39 d. (x+12)²=-2

Respuesta :

Otras preguntas

simplify the expression using sum or difference identities cos(12)cos(-3)-sin(12)sin(-3)

What is the variable of 72=9x+9

New Mexico’s. Five largest cities are Albuquerque, Santa Fe, las cruces, Roswell and farmington. What sentence structure is this

(Thermodynamics) Ag_2S can be prepared by heating a mixture of Ag and S. How many grams of Ag must react to produce 567.9kJ of energy?

The ____________ class of Rome lived in apartment buildings. A. aristocratic B. equestrian C. slave D. common

how do you graph y= 4x - 9

A water park offers two types of membership an unlimited use for $70 per month or a monthly $10 fee and $5 per visit which is the better plan? What is way to do

I need to borrow some money from my parents as my deficit has ____________. A. Grown B. Increased C. Decreased D. A and B

Use the diagram to the right to complete the statement. If m

What is pie?I know it starts with a four, but I can’t remember the numbers after that.