kaitlinhallett kaitlinhallett

11-10-2020
Physics

contestada

What wave moves in the same direction as the force that created it?

Respuesta :

mya2441 mya2441

11-10-2020

The answer is longitudinal waves

Answer Link

Otras preguntas

helpp pleasee enough points

Can I please get help with this, I have no idea??

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

The height of Tower A is 734 feet more than Tower B. The two towers have a combined height of 1,740 feet. What are the heights of each tower

my father ( live ) ..........in a house near the river because he ( like) ......... Swimming.

3. A 28-year-old male patient is being evaluated for initial treatment of a first-degree burn, back of hand, involving 5% body surface, caused by steam, while h

helppp pleaseee enough points quick

. Tom and his family went to a restaurant for dinner. The bill came to $80. They wanted to leave an 18% tip. What is the total amount of money Tom had to pay fo

A cube is numbered 1 through 6. If the cube is rolled twice, how many of the possible outcomes will have two even numbers? 3 0 000 9 18 36

A clock was set on Monday at 8.30 a.m. On Tuesday, the following day, the clock showed 8.45 p.m. when the correct time was 8.30 p.m. How many minutes was the cl