Deshaunsocool Deshaunsocool

11-11-2020
Mathematics

contestada

Using you answer from the previous question, what is the length of side x??

Using you answer from the previous question what is the length of side x class=

Respuesta :

qiqiqiana qiqiqiana

11-11-2020

Answer:

9

Step-by-step explanation:

Answer Link

Otras preguntas

square roots of 2 7/9

“How does Shakespeare convey the complexities of jealousy in Othello?”

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

Write first 20 decimal dijits in the base 3

Someone answer theses please ASAPPP

what is recycling? what is the importance of recycling in nature? in Ecosystem

Use the quadratic formula to find the roots f(x)=x^2-10x+30

A rectangular prism has a length of 8 in., a width of 4 in., and a height of 2 in. The prism is filled with cubes that have edge lengths of 4 in. How many cubes

Find the product using suitable properties (a) 738 × 103 (b) 102 × 854

18. A rectangular tables has a length that is expressed as 5x + 6 and a width that is expressed as 2x - 3. Find the a) Area of the table b) Perimeter of the tab