jenniferonyekachi99 jenniferonyekachi99

10-05-2022
Mathematics

contestada

what is 30% of 40, work it out

Respuesta :

kilom725 kilom725

10-05-2022

Answer:

your answer is 12.

30%×40 Is how you work it out.

Answer Link

Otras preguntas

How does increasing the amount of charge on an object affect the electric force it exerts on another charged objec

In 3-5 sentences, describe how the following people broke barriers by assuming positions of power : Colin Powell, Condoleezza Rice, and Hillary Clinton.

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

Exam-style questions: Short answer and data response fall in 1 Sarah owns a business which manufactures musical instruments. There has been an increase in sales

Scalper buys 10,000 tickets and resell them for $150 each. How much does the scalper earn?

When ice melts at 0C its volume decreases. Is the internal energy change greater than, less than, or equal to the heat added? How can you tell?

A rectangular prism’s volume is represented by the polynomial 3x^3-2x^2-15. The height of that prism is x-4 . What is the area of the base of the prism? HELP PL

If an organism is in the genus Canis, what family is it in ? A B C D

PLEASE HELP ME ASAP!!!

Factorise : 625y ^ 2 + 400y - 36 + 20z - z ^ 2