daisahbrown1224 daisahbrown1224

10-04-2018
Mathematics

contestada

why is it that a rectangular prism is not a cube

Respuesta :

mrkmusvovzdeq mrkmusvovzdeq

10-04-2018

Because A Rectangle is not a Cube?

Answer Link

AelinFeyre AelinFeyre

10-04-2018

A rectangular prism is not a cube because not all of the sides have to be the same length to be a rectangular prism

Answer Link

Otras preguntas

Find 7.4 times the difference between 64 and 17

Although the liver normally develops on the right side of the body, the liver can appear on the left side of the body in some people with situs inversus. Which

19. There is said to be a short circuit when A. one part of a parallel circuit has a very low resistance and almost all the current will flow through this part

what is the implied main idea?

Exam-style questions: Short answer and data response fall in 1 Sarah owns a business which manufactures musical instruments. There has been an increase in sales

log14/3 +log11/5-log22/15=log

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

show that 2x +1 is a factor of 2x3 +5x2+4x+1 and factories completely

Explain any five significance of Easter to Christians

what is recycling? what is the importance of recycling in nature? in Ecosystem